C21H29NO2 — CID 102423715
(10E,12E)-N-benzyl-5-oxotetradeca-10,12-dienamide (PubChem CID 102423715) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (10E,12E)-N-benzyl-5-oxotetradeca-10,12-dienamide.
| Compound Name | (10E,12E)-N-benzyl-5-oxotetradeca-10,12-dienamide |
|---|---|
| PubChem CID | 102423715 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (10E,12E)-N-benzyl-5-oxotetradeca-10,12-dienamide |
| SMILES | C/C=C/C=C/CCCCC(=O)CCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H29NO2/c1-2-3-4-5-6-7-11-15-20(23)16-12-17-21(24)22-18-19-13-9-8-10-14-19/h2-5,8-10,13-14H,6-7,11-12,15-18H2,1H3,(H,22,24)/b3-2+,5-4+ |
| InChIKey | LIRMGYHGKWDKBQ-MQQKCMAXSA-N |
| XLogP | 4.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|