About N-benzyl-6-oxohexanamide
N-benzyl-6-oxohexanamide (PubChem CID 172715262) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is N-benzyl-6-oxohexanamide.
Molecular Properties
| Compound Name | N-benzyl-6-oxohexanamide |
| PubChem CID | 172715262 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-benzyl-6-oxohexanamide |
| SMILES | O=CCCCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H17NO2/c15-10-6-2-5-9-13(16)14-11-12-7-3-1-4-8-12/h1,3-4,7-8,10H,2,5-6,9,11H2,(H,14,16) |
| InChIKey | FTVXFHTZIQWXHD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-6-oxohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-6-oxohexanamide?
The IUPAC name of N-benzyl-6-oxohexanamide (CID 172715262) is N-benzyl-6-oxohexanamide.
What is the SMILES notation for N-benzyl-6-oxohexanamide?
The canonical SMILES for N-benzyl-6-oxohexanamide is O=CCCCCC(=O)NCc1ccccc1.
What is the InChIKey of N-benzyl-6-oxohexanamide?
The InChIKey is FTVXFHTZIQWXHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c15-10-6-2-5-9-13(16)14-11-12-7-3-1-4-8-12/h1,3-4,7-8,10H,2,5-6,9,11H2,(H,14,16).
What are the key properties of N-benzyl-6-oxohexanamide?
N-benzyl-6-oxohexanamide has a molecular weight of 219.28 g/mol, XLogP of 2.06, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-6-oxohexanamide is sourced from PubChem (CID 172715262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).