C13H17ClN2O4S — CID 95334613
1-[(4-chloro-2-methoxyphenyl)methyl]-3-[(3S)-1,1-dioxothiolan-3-yl]urea (PubChem CID 95334613) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is 1-[(4-chloro-2-methoxyphenyl)methyl]-3-[(3S)-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-[(4-chloro-2-methoxyphenyl)methyl]-3-[(3S)-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 95334613 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-[(4-chloro-2-methoxyphenyl)methyl]-3-[(3S)-1,1-dioxothiolan-3-yl]urea |
| SMILES | COc1cc(Cl)ccc1CNC(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17ClN2O4S/c1-20-12-6-10(14)3-2-9(12)7-15-13(17)16-11-4-5-21(18,19)8-11/h2-3,6,11H,4-5,7-8H2,1H3,(H2,15,16,17)/t11-/m0/s1 |
| InChIKey | ONTVIOPXOHPNSE-NSHDSACASA-N |
| XLogP | 1.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |