C17H24ClN3O4 — CID 122001341
2-[[3-[(4-chloro-2-methoxyphenyl)methylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122001341) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is 2-[[3-[(4-chloro-2-methoxyphenyl)methylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[(4-chloro-2-methoxyphenyl)methylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122001341 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[[3-[(4-chloro-2-methoxyphenyl)methylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)NCc2ccc(Cl)cc2OC)C1 |
| InChI | InChI=1S/C17H24ClN3O4/c1-3-21(10-16(22)23)14-7-13(8-14)20-17(24)19-9-11-4-5-12(18)6-15(11)25-2/h4-6,13-14H,3,7-10H2,1-2H3,(H,22,23)(H2,19,20,24) |
| InChIKey | JNIQONHOQHNZNC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |