C20H29N3O4 — CID 122016705
2-[ethyl-[3-[[3-(3-methoxyphenyl)cyclobutyl]carbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122016705) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[ethyl-[3-[[3-(3-methoxyphenyl)cyclobutyl]carbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[[3-(3-methoxyphenyl)cyclobutyl]carbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122016705 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-[ethyl-[3-[[3-(3-methoxyphenyl)cyclobutyl]carbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)NC2CC(c3cccc(OC)c3)C2)C1 |
| InChI | InChI=1S/C20H29N3O4/c1-3-23(12-19(24)25)17-10-16(11-17)22-20(26)21-15-7-14(8-15)13-5-4-6-18(9-13)27-2/h4-6,9,14-17H,3,7-8,10-12H2,1-2H3,(H,24,25)(H2,21,22,26) |
| InChIKey | AYYJZEFZEGONPX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |