C19H29N3O5 — CID 122076815
2-[ethyl-[3-[[4-(2-methoxyethoxy)-2-methylphenyl]carbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122076815) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[ethyl-[3-[[4-(2-methoxyethoxy)-2-methylphenyl]carbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[[4-(2-methoxyethoxy)-2-methylphenyl]carbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122076815 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-[ethyl-[3-[[4-(2-methoxyethoxy)-2-methylphenyl]carbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)Nc2ccc(OCCOC)cc2C)C1 |
| InChI | InChI=1S/C19H29N3O5/c1-4-22(12-18(23)24)15-10-14(11-15)20-19(25)21-17-6-5-16(9-13(17)2)27-8-7-26-3/h5-6,9,14-15H,4,7-8,10-12H2,1-3H3,(H,23,24)(H2,20,21,25) |
| InChIKey | CDFZEDXXWUFDQJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|