C17H23ClFN3O4 — CID 122016450
2-[[3-[2-(4-chloro-3-fluorophenoxy)ethylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122016450) has the molecular formula C17H23ClFN3O4 and a molecular weight of 387.84 g/mol. Its IUPAC name is 2-[[3-[2-(4-chloro-3-fluorophenoxy)ethylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[2-(4-chloro-3-fluorophenoxy)ethylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122016450 |
| Molecular Formula | C17H23ClFN3O4 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[[3-[2-(4-chloro-3-fluorophenoxy)ethylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)NCCOc2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C17H23ClFN3O4/c1-2-22(10-16(23)24)12-7-11(8-12)21-17(25)20-5-6-26-13-3-4-14(18)15(19)9-13/h3-4,9,11-12H,2,5-8,10H2,1H3,(H,23,24)(H2,20,21,25) |
| InChIKey | OFNPALZKAWSSGR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|