C19H27FN4O4 — CID 122001646
2-[ethyl-[3-[3-[(3-fluorobenzoyl)amino]propylcarbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122001646) has the molecular formula C19H27FN4O4 and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[ethyl-[3-[3-[(3-fluorobenzoyl)amino]propylcarbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[3-[(3-fluorobenzoyl)amino]propylcarbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122001646 |
| Molecular Formula | C19H27FN4O4 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[ethyl-[3-[3-[(3-fluorobenzoyl)amino]propylcarbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)NCCCNC(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H27FN4O4/c1-2-24(12-17(25)26)16-10-15(11-16)23-19(28)22-8-4-7-21-18(27)13-5-3-6-14(20)9-13/h3,5-6,9,15-16H,2,4,7-8,10-12H2,1H3,(H,21,27)(H,25,26)(H2,22,23,28) |
| InChIKey | ZDVLXHORGJRSOR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|