C18H27N3O3 — CID 122002549
2-[ethyl-[3-[2-(4-methylphenyl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122002549) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-[ethyl-[3-[2-(4-methylphenyl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[2-(4-methylphenyl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122002549 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-[ethyl-[3-[2-(4-methylphenyl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)NCCc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C18H27N3O3/c1-3-21(12-17(22)23)16-10-15(11-16)20-18(24)19-9-8-14-6-4-13(2)5-7-14/h4-7,15-16H,3,8-12H2,1-2H3,(H,22,23)(H2,19,20,24) |
| InChIKey | ZAICQENXXHJXKQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |