C17H23F2N3O3 — CID 122010152
2-[[3-[[4-(difluoromethyl)phenyl]methylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122010152) has the molecular formula C17H23F2N3O3 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[[3-[[4-(difluoromethyl)phenyl]methylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[[4-(difluoromethyl)phenyl]methylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122010152 |
| Molecular Formula | C17H23F2N3O3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-[[3-[[4-(difluoromethyl)phenyl]methylcarbamoylamino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)NCc2ccc(C(F)F)cc2)C1 |
| InChI | InChI=1S/C17H23F2N3O3/c1-2-22(10-15(23)24)14-7-13(8-14)21-17(25)20-9-11-3-5-12(6-4-11)16(18)19/h3-6,13-14,16H,2,7-10H2,1H3,(H,23,24)(H2,20,21,25) |
| InChIKey | NZYPOIPMJQAWPB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |