C18H22FN3O3 — CID 122026580
2-[ethyl-[3-[1-(4-fluorophenyl)prop-2-ynylcarbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122026580) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[ethyl-[3-[1-(4-fluorophenyl)prop-2-ynylcarbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[1-(4-fluorophenyl)prop-2-ynylcarbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122026580 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[ethyl-[3-[1-(4-fluorophenyl)prop-2-ynylcarbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | C#CC(NC(=O)NC1CC(N(CC)CC(=O)O)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN3O3/c1-3-16(12-5-7-13(19)8-6-12)21-18(25)20-14-9-15(10-14)22(4-2)11-17(23)24/h1,5-8,14-16H,4,9-11H2,2H3,(H,23,24)(H2,20,21,25) |
| InChIKey | RSKYSJNGEREROI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|