C15H20ClN3O3 — CID 122073561
2-[[3-[(4-chlorophenyl)carbamoylamino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122073561) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-[[3-[(4-chlorophenyl)carbamoylamino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[(4-chlorophenyl)carbamoylamino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122073561 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[[3-[(4-chlorophenyl)carbamoylamino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-2-19(9-14(20)21)13-7-12(8-13)18-15(22)17-11-5-3-10(16)4-6-11/h3-6,12-13H,2,7-9H2,1H3,(H,20,21)(H2,17,18,22) |
| InChIKey | NJJYSYYNWIUSDB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |