C20H30N4O4 — CID 122075351
2-[[3-[[4-(tert-butylcarbamoyl)phenyl]carbamoylamino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122075351) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-[[3-[[4-(tert-butylcarbamoyl)phenyl]carbamoylamino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[[4-(tert-butylcarbamoyl)phenyl]carbamoylamino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122075351 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 2-[[3-[[4-(tert-butylcarbamoyl)phenyl]carbamoylamino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)Nc2ccc(C(=O)NC(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C20H30N4O4/c1-5-24(12-17(25)26)16-10-15(11-16)22-19(28)21-14-8-6-13(7-9-14)18(27)23-20(2,3)4/h6-9,15-16H,5,10-12H2,1-4H3,(H,23,27)(H,25,26)(H2,21,22,28) |
| InChIKey | OUUWATXBHPSTJL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |