C17H24FN3O3 — CID 122087509
2-[ethyl-[3-[(4-ethyl-3-fluorophenyl)carbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122087509) has the molecular formula C17H24FN3O3 and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-[ethyl-[3-[(4-ethyl-3-fluorophenyl)carbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[(4-ethyl-3-fluorophenyl)carbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122087509 |
| Molecular Formula | C17H24FN3O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-[ethyl-[3-[(4-ethyl-3-fluorophenyl)carbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCc1ccc(NC(=O)NC2CC(N(CC)CC(=O)O)C2)cc1F |
| InChI | InChI=1S/C17H24FN3O3/c1-3-11-5-6-12(9-15(11)18)19-17(24)20-13-7-14(8-13)21(4-2)10-16(22)23/h5-6,9,13-14H,3-4,7-8,10H2,1-2H3,(H,22,23)(H2,19,20,24) |
| InChIKey | LDTWIELVHLEHAI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |