C18H26ClN3O5 — CID 122077416
2-[[3-[[3-chloro-4-(2-methoxyethoxy)phenyl]carbamoylamino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122077416) has the molecular formula C18H26ClN3O5 and a molecular weight of 399.88 g/mol. Its IUPAC name is 2-[[3-[[3-chloro-4-(2-methoxyethoxy)phenyl]carbamoylamino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[[3-chloro-4-(2-methoxyethoxy)phenyl]carbamoylamino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122077416 |
| Molecular Formula | C18H26ClN3O5 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-[[3-[[3-chloro-4-(2-methoxyethoxy)phenyl]carbamoylamino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)Nc2ccc(OCCOC)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H26ClN3O5/c1-3-22(11-17(23)24)14-8-13(9-14)21-18(25)20-12-4-5-16(15(19)10-12)27-7-6-26-2/h4-5,10,13-14H,3,6-9,11H2,1-2H3,(H,23,24)(H2,20,21,25) |
| InChIKey | IHTREJRCQKAYGI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|