C15H29N3O3S — CID 122007958
2-[ethyl-[3-[2-(2-methylpropylsulfanyl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122007958) has the molecular formula C15H29N3O3S and a molecular weight of 331.48 g/mol. Its IUPAC name is 2-[ethyl-[3-[2-(2-methylpropylsulfanyl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[2-(2-methylpropylsulfanyl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122007958 |
| Molecular Formula | C15H29N3O3S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-[ethyl-[3-[2-(2-methylpropylsulfanyl)ethylcarbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)NCCSCC(C)C)C1 |
| InChI | InChI=1S/C15H29N3O3S/c1-4-18(9-14(19)20)13-7-12(8-13)17-15(21)16-5-6-22-10-11(2)3/h11-13H,4-10H2,1-3H3,(H,19,20)(H2,16,17,21) |
| InChIKey | SWPOKRZCGYMJRU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|