C19H29N3O4 — CID 122076851
2-[ethyl-[3-[(4-methyl-2-propoxyphenyl)carbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122076851) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[ethyl-[3-[(4-methyl-2-propoxyphenyl)carbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[(4-methyl-2-propoxyphenyl)carbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122076851 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-[ethyl-[3-[(4-methyl-2-propoxyphenyl)carbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCCOc1cc(C)ccc1NC(=O)NC1CC(N(CC)CC(=O)O)C1 |
| InChI | InChI=1S/C19H29N3O4/c1-4-8-26-17-9-13(3)6-7-16(17)21-19(25)20-14-10-15(11-14)22(5-2)12-18(23)24/h6-7,9,14-15H,4-5,8,10-12H2,1-3H3,(H,23,24)(H2,20,21,25) |
| InChIKey | CMRGULUNZQMGLG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |