C18H18FNO3S2 — CID 46558649
(E)-N-(1,1-dioxothiolan-3-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-methylprop-2-enamide (PubChem CID 46558649) has the molecular formula C18H18FNO3S2 and a molecular weight of 379.48 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 46558649 |
| Molecular Formula | C18H18FNO3S2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-methylprop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1ccc(-c2ccc(F)cc2)s1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H18FNO3S2/c1-20(15-10-11-25(22,23)12-15)18(21)9-7-16-6-8-17(24-16)13-2-4-14(19)5-3-13/h2-9,15H,10-12H2,1H3/b9-7+ |
| InChIKey | WFACLUCVBRQOPT-VQHVLOKHSA-N |
| XLogP | 3.21 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|