C23H27NO5S2 — CID 55394563
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate (PubChem CID 55394563) has the molecular formula C23H27NO5S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55394563 |
| Molecular Formula | C23H27NO5S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
| SMILES | CC(C)CN(C(=O)COC(=O)/C=C/c1ccc(-c2ccccc2)s1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H27NO5S2/c1-17(2)14-24(19-12-13-31(27,28)16-19)22(25)15-29-23(26)11-9-20-8-10-21(30-20)18-6-4-3-5-7-18/h3-11,17,19H,12-16H2,1-2H3/b11-9+ |
| InChIKey | NYUBIPMTPWUZIY-PKNBQFBNSA-N |
| XLogP | 3.64 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|