C19H24BrNO5S — CID 4239390
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 3-(3-bromophenyl)prop-2-enoate (PubChem CID 4239390) has the molecular formula C19H24BrNO5S and a molecular weight of 458.37 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4239390 |
| Molecular Formula | C19H24BrNO5S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 3-(3-bromophenyl)prop-2-enoate |
| SMILES | CC(C)CN(C(=O)COC(=O)C=Cc1cccc(Br)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H24BrNO5S/c1-14(2)11-21(17-8-9-27(24,25)13-17)18(22)12-26-19(23)7-6-15-4-3-5-16(20)10-15/h3-7,10,14,17H,8-9,11-13H2,1-2H3 |
| InChIKey | RWOOEZKPHJQGDY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|