C20H27NO5S — CID 7883025
[2-[[(2R)-butan-2-yl]-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(3-methylphenyl)prop-2-enoate (PubChem CID 7883025) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(3-methylphenyl)prop-2-enoate.
| Compound Name | [2-[[(2R)-butan-2-yl]-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(3-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7883025 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(3-methylphenyl)prop-2-enoate |
| SMILES | CC[C@@H](C)N(C(=O)COC(=O)/C=C/c1cccc(C)c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H27NO5S/c1-4-16(3)21(18-10-11-27(24,25)14-18)19(22)13-26-20(23)9-8-17-7-5-6-15(2)12-17/h5-9,12,16,18H,4,10-11,13-14H2,1-3H3/b9-8+/t16-,18+/m1/s1 |
| InChIKey | NCPSCCGXXQJPIF-FDRAFAAVSA-N |
| XLogP | 2.37 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|