C19H25NO5S — CID 8956065
[(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] (E)-3-(3-methylphenyl)prop-2-enoate (PubChem CID 8956065) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is [(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] (E)-3-(3-methylphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] (E)-3-(3-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8956065 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [(2R)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] (E)-3-(3-methylphenyl)prop-2-enoate |
| SMILES | CCN(C(=O)[C@@H](C)OC(=O)/C=C/c1cccc(C)c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H25NO5S/c1-4-20(17-10-11-26(23,24)13-17)19(22)15(3)25-18(21)9-8-16-7-5-6-14(2)12-16/h5-9,12,15,17H,4,10-11,13H2,1-3H3/b9-8+/t15-,17-/m1/s1 |
| InChIKey | IVHJJLJLWLHQIN-PJZFAXFVSA-N |
| XLogP | 1.98 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|