C14H20N2O3S2 — CID 75407883
(E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 75407883) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75407883 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | CC(C)(C)c1ncc(/C=C/C(=O)NC2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-14(2,3)13-15-8-11(20-13)4-5-12(17)16-10-6-7-21(18,19)9-10/h4-5,8,10H,6-7,9H2,1-3H3,(H,16,17)/b5-4+ |
| InChIKey | JXZJJYQEJFWBQH-SNAWJCMRSA-N |
| XLogP | 1.76 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|