C14H14N2O4S — CID 38833129
(E)-3-(1,3-benzoxazol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide (PubChem CID 38833129) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 38833129 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2o1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H14N2O4S/c17-13(15-10-7-8-21(18,19)9-10)5-6-14-16-11-3-1-2-4-12(11)20-14/h1-6,10H,7-9H2,(H,15,17)/b6-5+/t10-/m1/s1 |
| InChIKey | RTJQKAQIHJRXOY-BRAIEQGRSA-N |
| XLogP | 1.14 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|