C15H18N2O4S — CID 39397535
4-(1,3-benzoxazol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]butanamide (PubChem CID 39397535) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]butanamide.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]butanamide |
|---|---|
| PubChem CID | 39397535 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]butanamide |
| SMILES | O=C(CCCc1nc2ccccc2o1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N2O4S/c18-14(16-11-8-9-22(19,20)10-11)6-3-7-15-17-12-4-1-2-5-13(12)21-15/h1-2,4-5,11H,3,6-10H2,(H,16,18)/t11-/m1/s1 |
| InChIKey | QFSJXSSJNTVKTG-LLVKDONJSA-N |
| XLogP | 1.45 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |