C16H18N2O4S — CID 18137647
N-(1,1-dioxothiolan-3-yl)-3-(5-phenyl-1,3-oxazol-2-yl)propanamide (PubChem CID 18137647) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(5-phenyl-1,3-oxazol-2-yl)propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(5-phenyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 18137647 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(5-phenyl-1,3-oxazol-2-yl)propanamide |
| SMILES | O=C(CCc1ncc(-c2ccccc2)o1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18N2O4S/c19-15(18-13-8-9-23(20,21)11-13)6-7-16-17-10-14(22-16)12-4-2-1-3-5-12/h1-5,10,13H,6-9,11H2,(H,18,19) |
| InChIKey | MVAVLWBENVSOCL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |