C13H22N2O2S2 — CID 63921924
N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1,1-dioxothian-3-amine (PubChem CID 63921924) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.46 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63921924 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1,1-dioxothian-3-amine |
| SMILES | CC(C)(C)c1ncc(CNC2CCCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C13H22N2O2S2/c1-13(2,3)12-15-8-11(18-12)7-14-10-5-4-6-19(16,17)9-10/h8,10,14H,4-7,9H2,1-3H3 |
| InChIKey | UMLDSTSZPONESD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |