C10H17N3O2S — CID 63922530
N-[(2-methyl-1H-imidazol-5-yl)methyl]-1,1-dioxothian-3-amine (PubChem CID 63922530) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-[(2-methyl-1H-imidazol-5-yl)methyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[(2-methyl-1H-imidazol-5-yl)methyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63922530 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-[(2-methyl-1H-imidazol-5-yl)methyl]-1,1-dioxothian-3-amine |
| SMILES | Cc1ncc(CNC2CCCS(=O)(=O)C2)[nH]1 |
| InChI | InChI=1S/C10H17N3O2S/c1-8-11-5-10(13-8)6-12-9-3-2-4-16(14,15)7-9/h5,9,12H,2-4,6-7H2,1H3,(H,11,13) |
| InChIKey | LFMOVCYFZYDLLK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |