C9H15N3O2S — CID 63924406
1,1-dioxo-N-(1H-pyrazol-4-ylmethyl)thian-3-amine (PubChem CID 63924406) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 1,1-dioxo-N-(1H-pyrazol-4-ylmethyl)thian-3-amine.
| Compound Name | 1,1-dioxo-N-(1H-pyrazol-4-ylmethyl)thian-3-amine |
|---|---|
| PubChem CID | 63924406 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1,1-dioxo-N-(1H-pyrazol-4-ylmethyl)thian-3-amine |
| SMILES | O=S1(=O)CCCC(NCc2cn[nH]c2)C1 |
| InChI | InChI=1S/C9H15N3O2S/c13-15(14)3-1-2-9(7-15)10-4-8-5-11-12-6-8/h5-6,9-10H,1-4,7H2,(H,11,12) |
| InChIKey | BTCUBSMGXGXOIP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |