C15H19N3O2S — CID 63923324
1,1-dioxo-N-[(4-pyrazol-1-ylphenyl)methyl]thian-3-amine (PubChem CID 63923324) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1,1-dioxo-N-[(4-pyrazol-1-ylphenyl)methyl]thian-3-amine.
| Compound Name | 1,1-dioxo-N-[(4-pyrazol-1-ylphenyl)methyl]thian-3-amine |
|---|---|
| PubChem CID | 63923324 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1,1-dioxo-N-[(4-pyrazol-1-ylphenyl)methyl]thian-3-amine |
| SMILES | O=S1(=O)CCCC(NCc2ccc(-n3cccn3)cc2)C1 |
| InChI | InChI=1S/C15H19N3O2S/c19-21(20)10-1-3-14(12-21)16-11-13-4-6-15(7-5-13)18-9-2-8-17-18/h2,4-9,14,16H,1,3,10-12H2 |
| InChIKey | HVDUUZAOHGFLTJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |