C14H17N3O2S — CID 43222635
N-[(4-imidazol-1-ylphenyl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 43222635) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is N-[(4-imidazol-1-ylphenyl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(4-imidazol-1-ylphenyl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43222635 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-[(4-imidazol-1-ylphenyl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCc2ccc(-n3ccnc3)cc2)C1 |
| InChI | InChI=1S/C14H17N3O2S/c18-20(19)8-5-13(10-20)16-9-12-1-3-14(4-2-12)17-7-6-15-11-17/h1-4,6-7,11,13,16H,5,8-10H2 |
| InChIKey | WEFLBSBMGSPZOL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |