C9H15N3O2S — CID 63922123
N-(1H-imidazol-2-ylmethyl)-1,1-dioxothian-3-amine (PubChem CID 63922123) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-1,1-dioxothian-3-amine.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63922123 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-1,1-dioxothian-3-amine |
| SMILES | O=S1(=O)CCCC(NCc2ncc[nH]2)C1 |
| InChI | InChI=1S/C9H15N3O2S/c13-15(14)5-1-2-8(7-15)12-6-9-10-3-4-11-9/h3-4,8,12H,1-2,5-7H2,(H,10,11) |
| InChIKey | ZFZNEDJOGTULMQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |