C11H18N2O3S — CID 167896193
N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine (PubChem CID 167896193) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 167896193 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine |
| SMILES | CCc1nc(CNC2CCCS(=O)(=O)C2)co1 |
| InChI | InChI=1S/C11H18N2O3S/c1-2-11-13-10(7-16-11)6-12-9-4-3-5-17(14,15)8-9/h7,9,12H,2-6,8H2,1H3 |
| InChIKey | FFEOASZBLJQIRI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |