About N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine
N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine (PubChem CID 167896193) has the molecular formula C11H18N2O3S
and a molecular weight of 258.34 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine.
Molecular Properties
| Compound Name | N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine |
| PubChem CID | 167896193 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine |
| SMILES | CCc1nc(CNC2CCCS(=O)(=O)C2)co1 |
| InChI | InChI=1S/C11H18N2O3S/c1-2-11-13-10(7-16-11)6-12-9-4-3-5-17(14,15)8-9/h7,9,12H,2-6,8H2,1H3 |
| InChIKey | FFEOASZBLJQIRI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine?
The IUPAC name of N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine (CID 167896193) is N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine.
What is the SMILES notation for N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine?
The canonical SMILES for N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine is CCc1nc(CNC2CCCS(=O)(=O)C2)co1.
What is the InChIKey of N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine?
The InChIKey is FFEOASZBLJQIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3S/c1-2-11-13-10(7-16-11)6-12-9-4-3-5-17(14,15)8-9/h7,9,12H,2-6,8H2,1H3.
What are the key properties of N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine?
N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine has a molecular weight of 258.34 g/mol, XLogP of 0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-1,1-dioxothian-3-amine is sourced from PubChem (CID 167896193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).