C10H15F2N3 — CID 126782159
4,4-difluoro-N-(1H-imidazol-2-ylmethyl)cyclohexan-1-amine (PubChem CID 126782159) has the molecular formula C10H15F2N3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 4,4-difluoro-N-(1H-imidazol-2-ylmethyl)cyclohexan-1-amine.
| Compound Name | 4,4-difluoro-N-(1H-imidazol-2-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 126782159 |
| Molecular Formula | C10H15F2N3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 4,4-difluoro-N-(1H-imidazol-2-ylmethyl)cyclohexan-1-amine |
| SMILES | FC1(F)CCC(NCc2ncc[nH]2)CC1 |
| InChI | InChI=1S/C10H15F2N3/c11-10(12)3-1-8(2-4-10)15-7-9-13-5-6-14-9/h5-6,8,15H,1-4,7H2,(H,13,14) |
| InChIKey | CRUNGZQKUWBJSD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |