C11H19N3 — CID 114544080
3-methyl-N-[(2-methyl-1H-imidazol-5-yl)methyl]cyclopentan-1-amine (PubChem CID 114544080) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-methyl-N-[(2-methyl-1H-imidazol-5-yl)methyl]cyclopentan-1-amine.
| Compound Name | 3-methyl-N-[(2-methyl-1H-imidazol-5-yl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 114544080 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 3-methyl-N-[(2-methyl-1H-imidazol-5-yl)methyl]cyclopentan-1-amine |
| SMILES | Cc1ncc(CNC2CCC(C)C2)[nH]1 |
| InChI | InChI=1S/C11H19N3/c1-8-3-4-10(5-8)13-7-11-6-12-9(2)14-11/h6,8,10,13H,3-5,7H2,1-2H3,(H,12,14) |
| InChIKey | HRGWOASCCKIBND-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |