C17H27N5S — CID 95610696
(6S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95610696) has the molecular formula C17H27N5S and a molecular weight of 333.51 g/mol. Its IUPAC name is (6S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95610696 |
| Molecular Formula | C17H27N5S |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | (6S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CC(C)c1nc2n(n1)C[C@@H](NCc1cnc(C(C)(C)C)s1)CC2 |
| InChI | InChI=1S/C17H27N5S/c1-11(2)15-20-14-7-6-12(10-22(14)21-15)18-8-13-9-19-16(23-13)17(3,4)5/h9,11-12,18H,6-8,10H2,1-5H3/t12-/m0/s1 |
| InChIKey | ZLZJFBOLIAEQMX-LBPRGKRZSA-N |
| XLogP | 3.26 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |