C12H17N5S — CID 95609048
(6R)-2-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95609048) has the molecular formula C12H17N5S and a molecular weight of 263.37 g/mol. Its IUPAC name is (6R)-2-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-2-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95609048 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (6R)-2-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1nc2n(n1)C[C@H](NCc1cnc(C)s1)CC2 |
| InChI | InChI=1S/C12H17N5S/c1-8-15-12-4-3-10(7-17(12)16-8)14-6-11-5-13-9(2)18-11/h5,10,14H,3-4,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | IEXWWZROHQSCIZ-SNVBAGLBSA-N |
| XLogP | 1.46 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |