C12H17N5O — CID 95346870
(6R)-2-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95346870) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is (6R)-2-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-2-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95346870 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (6R)-2-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1nc2n(n1)C[C@H](NCc1cc(C)on1)CC2 |
| InChI | InChI=1S/C12H17N5O/c1-8-5-11(16-18-8)6-13-10-3-4-12-14-9(2)15-17(12)7-10/h5,10,13H,3-4,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | DGVMKZXROOTXFR-SNVBAGLBSA-N |
| XLogP | 0.99 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |