C17H18ClN5O — CID 95758135
(6R)-N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95758135) has the molecular formula C17H18ClN5O and a molecular weight of 343.82 g/mol. Its IUPAC name is (6R)-N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95758135 |
| Molecular Formula | C17H18ClN5O |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (6R)-N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1nc2n(n1)C[C@H](NCc1ncc(-c3ccc(Cl)cc3)o1)CC2 |
| InChI | InChI=1S/C17H18ClN5O/c1-11-21-16-7-6-14(10-23(16)22-11)19-9-17-20-8-15(24-17)12-2-4-13(18)5-3-12/h2-5,8,14,19H,6-7,9-10H2,1H3/t14-/m1/s1 |
| InChIKey | ANCMHBYROUFWCI-CQSZACIVSA-N |
| XLogP | 3.00 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |