C15H17N5OS — CID 95346814
(6R)-2-methyl-N-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95346814) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is (6R)-2-methyl-N-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-2-methyl-N-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95346814 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (6R)-2-methyl-N-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1nc2n(n1)C[C@H](NCc1cc(-c3cccs3)on1)CC2 |
| InChI | InChI=1S/C15H17N5OS/c1-10-17-15-5-4-11(9-20(15)18-10)16-8-12-7-13(21-19-12)14-3-2-6-22-14/h2-3,6-7,11,16H,4-5,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | XVUFAFIMHKKKNZ-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |