C15H18N6OS — CID 95345834
(6S)-2-methyl-N-[(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95345834) has the molecular formula C15H18N6OS and a molecular weight of 330.42 g/mol. Its IUPAC name is (6S)-2-methyl-N-[(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-2-methyl-N-[(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95345834 |
| Molecular Formula | C15H18N6OS |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (6S)-2-methyl-N-[(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1nc2n(n1)C[C@@H](N[C@@H](C)c1nnc(-c3cccs3)o1)CC2 |
| InChI | InChI=1S/C15H18N6OS/c1-9(14-18-19-15(22-14)12-4-3-7-23-12)16-11-5-6-13-17-10(2)20-21(13)8-11/h3-4,7,9,11,16H,5-6,8H2,1-2H3/t9-,11-/m0/s1 |
| InChIKey | UGJAHWZNDTXVPP-ONGXEEELSA-N |
| XLogP | 2.36 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |