C14H16N6OS — CID 95304751
(6S)-N-[(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95304751) has the molecular formula C14H16N6OS and a molecular weight of 316.39 g/mol. Its IUPAC name is (6S)-N-[(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-[(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95304751 |
| Molecular Formula | C14H16N6OS |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (6S)-N-[(1S)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | C[C@H](N[C@H]1CCc2ncnn2C1)c1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C14H16N6OS/c1-9(13-18-19-14(21-13)11-3-2-6-22-11)17-10-4-5-12-15-8-16-20(12)7-10/h2-3,6,8-10,17H,4-5,7H2,1H3/t9-,10-/m0/s1 |
| InChIKey | RCXIMTLYXYKRSC-UWVGGRQHSA-N |
| XLogP | 2.06 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |