C15H16N4S2 — CID 95292850
(6S)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95292850) has the molecular formula C15H16N4S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (6S)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95292850 |
| Molecular Formula | C15H16N4S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (6S)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | c1csc(-c2csc(CN[C@H]3CCc4ncnn4C3)c2)c1 |
| InChI | InChI=1S/C15H16N4S2/c1-2-14(20-5-1)11-6-13(21-9-11)7-16-12-3-4-15-17-10-18-19(15)8-12/h1-2,5-6,9-10,12,16H,3-4,7-8H2/t12-/m0/s1 |
| InChIKey | IBQSZMOSORCGOT-LBPRGKRZSA-N |
| XLogP | 3.17 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |