C14H15N5S2 — CID 95291898
(6S)-N-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95291898) has the molecular formula C14H15N5S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is (6S)-N-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95291898 |
| Molecular Formula | C14H15N5S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (6S)-N-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | c1nc2n(n1)C[C@@H](NCc1csc(-c3ccsc3)n1)CC2 |
| InChI | InChI=1S/C14H15N5S2/c1-2-13-16-9-17-19(13)6-11(1)15-5-12-8-21-14(18-12)10-3-4-20-7-10/h3-4,7-9,11,15H,1-2,5-6H2/t11-/m0/s1 |
| InChIKey | JARMKHAERZCRFU-NSHDSACASA-N |
| XLogP | 2.57 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |