C16H21N5OS — CID 95323809
2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-1-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]ethanone (PubChem CID 95323809) has the molecular formula C16H21N5OS and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-1-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]ethanone.
| Compound Name | 2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-1-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95323809 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-1-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]ethanone |
| SMILES | O=C(CN[C@@H]1CCc2ncnn2C1)N1CCC[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C16H21N5OS/c22-16(20-6-1-2-14(20)12-5-7-23-10-12)8-17-13-3-4-15-18-11-19-21(15)9-13/h5,7,10-11,13-14,17H,1-4,6,8-9H2/t13-,14-/m1/s1 |
| InChIKey | MZBSGQHSAUOFFT-ZIAGYGMSSA-N |
| XLogP | 1.61 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |