C14H22N6O2 — CID 95607404
(2R)-1-[2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetyl]piperidine-2-carboxamide (PubChem CID 95607404) has the molecular formula C14H22N6O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2R)-1-[2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetyl]piperidine-2-carboxamide.
| Compound Name | (2R)-1-[2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 95607404 |
| Molecular Formula | C14H22N6O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2R)-1-[2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetyl]piperidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCCN1C(=O)CN[C@H]1CCc2ncnn2C1 |
| InChI | InChI=1S/C14H22N6O2/c15-14(22)11-3-1-2-6-19(11)13(21)7-16-10-4-5-12-17-9-18-20(12)8-10/h9-11,16H,1-8H2,(H2,15,22)/t10-,11+/m0/s1 |
| InChIKey | CPAATEFZWYNGGV-WDEREUQCSA-N |
| XLogP | -0.95 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |