C14H19N5OS — CID 95338892
N-methyl-2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 95338892) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is N-methyl-2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | N-methyl-2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 95338892 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-methyl-2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | CN(Cc1ccsc1)C(=O)CN[C@@H]1CCc2ncnn2C1 |
| InChI | InChI=1S/C14H19N5OS/c1-18(7-11-4-5-21-9-11)14(20)6-15-12-2-3-13-16-10-17-19(13)8-12/h4-5,9-10,12,15H,2-3,6-8H2,1H3/t12-/m1/s1 |
| InChIKey | ZHLJVQGVOBERDU-GFCCVEGCSA-N |
| XLogP | 0.90 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |