C10H16N2OS — CID 60685569
2-(ethylamino)-N-methyl-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 60685569) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-(ethylamino)-N-methyl-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | 2-(ethylamino)-N-methyl-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 60685569 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(ethylamino)-N-methyl-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | CCNCC(=O)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C10H16N2OS/c1-3-11-6-10(13)12(2)7-9-4-5-14-8-9/h4-5,8,11H,3,6-7H2,1-2H3 |
| InChIKey | HUJIDRAOWNMFSI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |