C10H13NO4S — CID 61328793
2-[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethoxy]acetic acid (PubChem CID 61328793) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61328793 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethoxy]acetic acid |
| SMILES | CN(Cc1ccsc1)C(=O)COCC(=O)O |
| InChI | InChI=1S/C10H13NO4S/c1-11(4-8-2-3-16-7-8)9(12)5-15-6-10(13)14/h2-3,7H,4-6H2,1H3,(H,13,14) |
| InChIKey | SJQYFWWVPNBUBU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |