C12H14ClNO4 — CID 54941021
2-[2-[(4-chlorophenyl)methyl-methylamino]-2-oxoethoxy]acetic acid (PubChem CID 54941021) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenyl)methyl-methylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(4-chlorophenyl)methyl-methylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 54941021 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[2-[(4-chlorophenyl)methyl-methylamino]-2-oxoethoxy]acetic acid |
| SMILES | CN(Cc1ccc(Cl)cc1)C(=O)COCC(=O)O |
| InChI | InChI=1S/C12H14ClNO4/c1-14(11(15)7-18-8-12(16)17)6-9-2-4-10(13)5-3-9/h2-5H,6-8H2,1H3,(H,16,17) |
| InChIKey | OWLJDDAZELHPIM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |